C13H8N4S — CID 17417188
4-(benzimidazol-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 17417188) has the molecular formula C13H8N4S and a molecular weight of 252.30 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(benzimidazol-1-yl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 17417188 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(benzimidazol-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | c1ccc2c(c1)ncn2-c1ncnc2sccc12 |
| InChI | InChI=1S/C13H8N4S/c1-2-4-11-10(3-1)16-8-17(11)12-9-5-6-18-13(9)15-7-14-12/h1-8H |
| InChIKey | XUTUJJHHJFFJCL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |