C15H12N4S — CID 1069561
4-(benzimidazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine (PubChem CID 1069561) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(benzimidazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 1069561 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-(benzimidazol-1-yl)-5,6-dimethylthieno[2,3-d]pyrimidine |
| SMILES | Cc1sc2ncnc(-n3cnc4ccccc43)c2c1C |
| InChI | InChI=1S/C15H12N4S/c1-9-10(2)20-15-13(9)14(16-7-17-15)19-8-18-11-5-3-4-6-12(11)19/h3-8H,1-2H3 |
| InChIKey | XWVHUTUPGMFKNO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |