C17H18N6S2 — CID 11850634
9-butyl-8-[(7-methyl-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine (PubChem CID 11850634) has the molecular formula C17H18N6S2 and a molecular weight of 370.51 g/mol. Its IUPAC name is 9-butyl-8-[(7-methyl-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-butyl-8-[(7-methyl-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 11850634 |
| Molecular Formula | C17H18N6S2 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 9-butyl-8-[(7-methyl-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine |
| SMILES | CCCCn1c(Sc2nc3cccc(C)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H18N6S2/c1-3-4-8-23-15-12(14(18)19-9-20-15)22-16(23)25-17-21-11-7-5-6-10(2)13(11)24-17/h5-7,9H,3-4,8H2,1-2H3,(H2,18,19,20) |
| InChIKey | XIOLYGPFGWRMPK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |