C14H11ClN6S2 — CID 11850636
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-ethylpurin-6-amine (PubChem CID 11850636) has the molecular formula C14H11ClN6S2 and a molecular weight of 362.87 g/mol. Its IUPAC name is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-ethylpurin-6-amine.
| Compound Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-ethylpurin-6-amine |
|---|---|
| PubChem CID | 11850636 |
| Molecular Formula | C14H11ClN6S2 |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-ethylpurin-6-amine |
| SMILES | CCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C14H11ClN6S2/c1-2-21-12-9(11(16)17-6-18-12)20-13(21)23-14-19-8-5-3-4-7(15)10(8)22-14/h3-6H,2H2,1H3,(H2,16,17,18) |
| InChIKey | PFJIUNGUDAQBRN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |