C16H15ClN6OS2 — CID 11849867
4-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]butan-1-ol (PubChem CID 11849867) has the molecular formula C16H15ClN6OS2 and a molecular weight of 406.92 g/mol. Its IUPAC name is 4-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]butan-1-ol.
| Compound Name | 4-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]butan-1-ol |
|---|---|
| PubChem CID | 11849867 |
| Molecular Formula | C16H15ClN6OS2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 4-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]butan-1-ol |
| SMILES | Nc1ncnc2c1nc(Sc1nc3cccc(Cl)c3s1)n2CCCCO |
| InChI | InChI=1S/C16H15ClN6OS2/c17-9-4-3-5-10-12(9)25-16(21-10)26-15-22-11-13(18)19-8-20-14(11)23(15)6-1-2-7-24/h3-5,8,24H,1-2,6-7H2,(H2,18,19,20) |
| InChIKey | NZRHMZHVOSRESC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|