C18H20ClN7S2 — CID 11850767
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 11850767) has the molecular formula C18H20ClN7S2 and a molecular weight of 433.99 g/mol. Its IUPAC name is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
| Compound Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 11850767 |
| Molecular Formula | C18H20ClN7S2 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | CC(C)NCCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H20ClN7S2/c1-10(2)21-7-4-8-26-16-13(15(20)22-9-23-16)25-17(26)28-18-24-12-6-3-5-11(19)14(12)27-18/h3,5-6,9-10,21H,4,7-8H2,1-2H3,(H2,20,22,23) |
| InChIKey | ZUYVJNMTTGHYQS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|