C17H14ClN7S2 — CID 11850700
5-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]pentanenitrile (PubChem CID 11850700) has the molecular formula C17H14ClN7S2 and a molecular weight of 415.94 g/mol. Its IUPAC name is 5-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]pentanenitrile.
| Compound Name | 5-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]pentanenitrile |
|---|---|
| PubChem CID | 11850700 |
| Molecular Formula | C17H14ClN7S2 |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 5-[6-amino-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-9-yl]pentanenitrile |
| SMILES | N#CCCCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H14ClN7S2/c18-10-5-4-6-11-13(10)26-17(23-11)27-16-24-12-14(20)21-9-22-15(12)25(16)8-3-1-2-7-19/h4-6,9H,1-3,8H2,(H2,20,21,22) |
| InChIKey | VDMMKENUYLBUEL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|