C15H13ClN6S2 — CID 11850697
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-propylpurin-6-amine (PubChem CID 11850697) has the molecular formula C15H13ClN6S2 and a molecular weight of 376.90 g/mol. Its IUPAC name is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-propylpurin-6-amine.
| Compound Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-propylpurin-6-amine |
|---|---|
| PubChem CID | 11850697 |
| Molecular Formula | C15H13ClN6S2 |
| Molecular Weight | 376.90 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-propylpurin-6-amine |
| SMILES | CCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C15H13ClN6S2/c1-2-6-22-13-10(12(17)18-7-19-13)21-14(22)24-15-20-9-5-3-4-8(16)11(9)23-15/h3-5,7H,2,6H2,1H3,(H2,17,18,19) |
| InChIKey | LQLZLKSOIZFQRN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.90 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |