C21H27N3O3Si — CID 167419750
2-[[8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 167419750) has the molecular formula C21H27N3O3Si and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-[[8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 167419750 |
| Molecular Formula | C21H27N3O3Si |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[[8-methoxy-6-(5-methyl-2-pyridinyl)quinazolin-4-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(-c2ccc(C)cn2)cc2c(OCOCC[Si](C)(C)C)ncnc12 |
| InChI | InChI=1S/C21H27N3O3Si/c1-15-6-7-18(22-12-15)16-10-17-20(19(11-16)25-2)23-13-24-21(17)27-14-26-8-9-28(3,4)5/h6-7,10-13H,8-9,14H2,1-5H3 |
| InChIKey | JIMIPVNZTVCQLB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|