C18H28O2Si — CID 10859695
2-[[2-(1-cyclopropylideneethyl)-5-methylphenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 10859695) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is 2-[[2-(1-cyclopropylideneethyl)-5-methylphenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(1-cyclopropylideneethyl)-5-methylphenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 10859695 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-[[2-(1-cyclopropylideneethyl)-5-methylphenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | CC(=C1CC1)c1ccc(C)cc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C18H28O2Si/c1-14-6-9-17(15(2)16-7-8-16)18(12-14)20-13-19-10-11-21(3,4)5/h6,9,12H,7-8,10-11,13H2,1-5H3 |
| InChIKey | YAUNIWPWSIEJNB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|