C14H23BrO2Si — CID 158102825
2-[(2-bromo-3,5-dimethylphenoxy)methoxy]ethyl-trimethylsilane (PubChem CID 158102825) has the molecular formula C14H23BrO2Si and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[(2-bromo-3,5-dimethylphenoxy)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-bromo-3,5-dimethylphenoxy)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 158102825 |
| Molecular Formula | C14H23BrO2Si |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[(2-bromo-3,5-dimethylphenoxy)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(C)c(Br)c(OCOCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C14H23BrO2Si/c1-11-8-12(2)14(15)13(9-11)17-10-16-6-7-18(3,4)5/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | VGAPGNVPSWBNMP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|