C22H43BrCl2O4Si2 — CID 90858279
2-[(4-bromo-2-methoxy-5-methylphenoxy)methoxy]ethyl-trimethylsilane;dichloromethane;2-ethoxyethyl(trimethyl)silane (PubChem CID 90858279) has the molecular formula C22H43BrCl2O4Si2 and a molecular weight of 578.56 g/mol. Its IUPAC name is 2-[(4-bromo-2-methoxy-5-methylphenoxy)methoxy]ethyl-trimethylsilane;dichloromethane;2-ethoxyethyl(trimethyl)silane.
| Compound Name | 2-[(4-bromo-2-methoxy-5-methylphenoxy)methoxy]ethyl-trimethylsilane;dichloromethane;2-ethoxyethyl(trimethyl)silane |
|---|---|
| PubChem CID | 90858279 |
| Molecular Formula | C22H43BrCl2O4Si2 |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 2-[(4-bromo-2-methoxy-5-methylphenoxy)methoxy]ethyl-trimethylsilane;dichloromethane;2-ethoxyethyl(trimethyl)silane |
| SMILES | CCOCC[Si](C)(C)C.COc1cc(Br)c(C)cc1OCOCC[Si](C)(C)C.ClCCl |
| InChI | InChI=1S/C14H23BrO3Si.C7H18OSi.CH2Cl2/c1-11-8-14(13(16-2)9-12(11)15)18-10-17-6-7-19(3,4)5;1-5-8-6-7-9(2,3)4;2-1-3/h8-9H,6-7,10H2,1-5H3;5-7H2,1-4H3;1H2 |
| InChIKey | BOEWUWCWDWAXRL-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|