C20H15ClFN5O — CID 155728512
N-[(5-chloropyrimidin-2-yl)methyl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine (PubChem CID 155728512) has the molecular formula C20H15ClFN5O and a molecular weight of 395.83 g/mol. Its IUPAC name is N-[(5-chloropyrimidin-2-yl)methyl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine.
| Compound Name | N-[(5-chloropyrimidin-2-yl)methyl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 155728512 |
| Molecular Formula | C20H15ClFN5O |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[(5-chloropyrimidin-2-yl)methyl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine |
| SMILES | COc1cc(-c2ccc(F)cc2)cc2c(NCc3ncc(Cl)cn3)ncnc12 |
| InChI | InChI=1S/C20H15ClFN5O/c1-28-17-7-13(12-2-4-15(22)5-3-12)6-16-19(17)26-11-27-20(16)25-10-18-23-8-14(21)9-24-18/h2-9,11H,10H2,1H3,(H,25,26,27) |
| InChIKey | AGDYEMINHQDOMR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |