C26H27FIN4O2- — CID 155728412
CID 155728412 (PubChem CID 155728412) has the molecular formula C26H27FIN4O2- and a molecular weight of 573.43 g/mol.
| Compound Name | CID 155728412 |
|---|---|
| PubChem CID | 155728412 |
| Molecular Formula | C26H27FIN4O2- |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | — |
| SMILES | CCOC(C)COc1cc(-c2ccc(F)cc2)cc2c(NCC3=C[I-]N=C(C)C=C3)ncnc12 |
| InChI | InChI=1S/C26H27FIN4O2/c1-4-33-18(3)15-34-24-12-21(20-7-9-22(27)10-8-20)11-23-25(24)30-16-31-26(23)29-14-19-6-5-17(2)32-28-13-19/h5-13,16,18H,4,14-15H2,1-3H3,(H,29,30,31)/q-1 |
| InChIKey | PZKXXEPCKIAUMT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|