C28H35FN4O — CID 155728403
N-[4-[(Z)-but-2-en-2-yl]imino-2,5-dimethylheptan-3-yl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine (PubChem CID 155728403) has the molecular formula C28H35FN4O and a molecular weight of 462.61 g/mol. Its IUPAC name is N-[4-[(Z)-but-2-en-2-yl]imino-2,5-dimethylheptan-3-yl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine.
| Compound Name | N-[4-[(Z)-but-2-en-2-yl]imino-2,5-dimethylheptan-3-yl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 155728403 |
| Molecular Formula | C28H35FN4O |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | N-[4-[(Z)-but-2-en-2-yl]imino-2,5-dimethylheptan-3-yl]-6-(4-fluorophenyl)-8-methoxyquinazolin-4-amine |
| SMILES | C/C=C(C)\N=C(/C(C)CC)C(Nc1ncnc2c(OC)cc(-c3ccc(F)cc3)cc12)C(C)C |
| InChI | InChI=1S/C28H35FN4O/c1-8-18(5)26(32-19(6)9-2)25(17(3)4)33-28-23-14-21(20-10-12-22(29)13-11-20)15-24(34-7)27(23)30-16-31-28/h9-18,25H,8H2,1-7H3,(H,30,31,33)/b19-9-,32-26+ |
| InChIKey | MSVYJDYBPJIFTP-HDRYZGMTSA-N |
| XLogP | 7.29 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|