C24H20F4N4O4 — CID 175708641
6-(4-fluorophenyl)-8-methoxy-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]quinazolin-4-amine;formic acid (PubChem CID 175708641) has the molecular formula C24H20F4N4O4 and a molecular weight of 504.44 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-8-methoxy-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]quinazolin-4-amine;formic acid.
| Compound Name | 6-(4-fluorophenyl)-8-methoxy-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]quinazolin-4-amine;formic acid |
|---|---|
| PubChem CID | 175708641 |
| Molecular Formula | C24H20F4N4O4 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 6-(4-fluorophenyl)-8-methoxy-N-[(1R)-1-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]ethyl]quinazolin-4-amine;formic acid |
| SMILES | COc1cc(-c2ccc(F)cc2)cc2c(N[C@H](C)c3ccc(C(F)(F)F)[n+]([O-])c3)ncnc12.O=CO |
| InChI | InChI=1S/C23H18F4N4O2.CH2O2/c1-13(15-5-8-20(23(25,26)27)31(32)11-15)30-22-18-9-16(14-3-6-17(24)7-4-14)10-19(33-2)21(18)28-12-29-22;2-1-3/h3-13H,1-2H3,(H,28,29,30);1H,(H,2,3)/t13-;/m1./s1 |
| InChIKey | NEXPQQLCQMPIQQ-BTQNPOSSSA-N |
| XLogP | 4.97 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|