C27H28FILiN4O2-3 — CID 155728411
CID 155728411 (PubChem CID 155728411) has the molecular formula C27H28FILiN4O2-3 and a molecular weight of 593.39 g/mol.
| Compound Name | CID 155728411 |
|---|---|
| PubChem CID | 155728411 |
| Molecular Formula | C27H28FILiN4O2-3 |
| Molecular Weight | 593.39 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | — |
| SMILES | [CH2-]COC([CH2-])COc1cc(-c2ccc(F)cc2)cc2c(NCC3=C[I-]N=C(C)C=C3)ncnc12.[CH3-].[Li+] |
| InChI | InChI=1S/C26H25FIN4O2.CH3.Li/c1-4-33-18(3)15-34-24-12-21(20-7-9-22(27)10-8-20)11-23-25(24)30-16-31-26(23)29-14-19-6-5-17(2)32-28-13-19;;/h5-13,16,18H,1,3-4,14-15H2,2H3,(H,29,30,31);1H3;/q-3;-1;+1 |
| InChIKey | PGDGRJACKWUENO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|