C15H22N4 — CID 133275480
N'-ethyl-N'-propan-2-yl-N-quinazolin-4-ylethane-1,2-diamine (PubChem CID 133275480) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is N'-ethyl-N'-propan-2-yl-N-quinazolin-4-ylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-propan-2-yl-N-quinazolin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 133275480 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N'-ethyl-N'-propan-2-yl-N-quinazolin-4-ylethane-1,2-diamine |
| SMILES | CCN(CCNc1ncnc2ccccc12)C(C)C |
| InChI | InChI=1S/C15H22N4/c1-4-19(12(2)3)10-9-16-15-13-7-5-6-8-14(13)17-11-18-15/h5-8,11-12H,4,9-10H2,1-3H3,(H,16,17,18) |
| InChIKey | LTURIXNHMCWYJE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |