C13H17N3 — CID 83179618
3-N-quinolin-4-ylbutane-1,3-diamine (PubChem CID 83179618) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-N-quinolin-4-ylbutane-1,3-diamine.
| Compound Name | 3-N-quinolin-4-ylbutane-1,3-diamine |
|---|---|
| PubChem CID | 83179618 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-N-quinolin-4-ylbutane-1,3-diamine |
| SMILES | CC(CCN)Nc1ccnc2ccccc12 |
| InChI | InChI=1S/C13H17N3/c1-10(6-8-14)16-13-7-9-15-12-5-3-2-4-11(12)13/h2-5,7,9-10H,6,8,14H2,1H3,(H,15,16) |
| InChIKey | WPFXJDAIGGQONV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |