C22H21N3O3 — CID 91964296
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(furan-2-yl)quinazolin-4-amine (PubChem CID 91964296) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(furan-2-yl)quinazolin-4-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(furan-2-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 91964296 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(furan-2-yl)quinazolin-4-amine |
| SMILES | COc1ccc(CCNc2nc(-c3ccco3)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C22H21N3O3/c1-26-18-10-9-15(14-20(18)27-2)11-12-23-21-16-6-3-4-7-17(16)24-22(25-21)19-8-5-13-28-19/h3-10,13-14H,11-12H2,1-2H3,(H,23,24,25) |
| InChIKey | XDZVPRQXUOFAMK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |