C15H14ClN4- — CID 53346777
2-methyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine chloride (PubChem CID 53346777) has the molecular formula C15H14ClN4- and a molecular weight of 285.76 g/mol. Its IUPAC name is 2-methyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine chloride.
| Compound Name | 2-methyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine chloride |
|---|---|
| PubChem CID | 53346777 |
| Molecular Formula | C15H14ClN4- |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-methyl-N-(pyridin-2-ylmethyl)quinazolin-4-amine chloride |
| SMILES | Cc1nc(NCc2ccccn2)c2ccccc2n1.[Cl-] |
| InChI | InChI=1S/C15H14N4.ClH/c1-11-18-14-8-3-2-7-13(14)15(19-11)17-10-12-6-4-5-9-16-12;/h2-9H,10H2,1H3,(H,17,18,19);1H/p-1 |
| InChIKey | OXWJWQIYUYZJCT-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |