C12H14N4 — CID 81132178
6-methyl-2-N-(pyridin-2-ylmethyl)pyridine-2,3-diamine (PubChem CID 81132178) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 6-methyl-2-N-(pyridin-2-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 6-methyl-2-N-(pyridin-2-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 81132178 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-methyl-2-N-(pyridin-2-ylmethyl)pyridine-2,3-diamine |
| SMILES | Cc1ccc(N)c(NCc2ccccn2)n1 |
| InChI | InChI=1S/C12H14N4/c1-9-5-6-11(13)12(16-9)15-8-10-4-2-3-7-14-10/h2-7H,8,13H2,1H3,(H,15,16) |
| InChIKey | QSHZNVQOKMUDDF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |