C14H6Cl2F2N2 — CID 114590146
4-chloro-2-(3-chlorophenyl)-6,7-difluoroquinazoline (PubChem CID 114590146) has the molecular formula C14H6Cl2F2N2 and a molecular weight of 311.12 g/mol. Its IUPAC name is 4-chloro-2-(3-chlorophenyl)-6,7-difluoroquinazoline.
| Compound Name | 4-chloro-2-(3-chlorophenyl)-6,7-difluoroquinazoline |
|---|---|
| PubChem CID | 114590146 |
| Molecular Formula | C14H6Cl2F2N2 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 4-chloro-2-(3-chlorophenyl)-6,7-difluoroquinazoline |
| SMILES | Fc1cc2nc(-c3cccc(Cl)c3)nc(Cl)c2cc1F |
| InChI | InChI=1S/C14H6Cl2F2N2/c15-8-3-1-2-7(4-8)14-19-12-6-11(18)10(17)5-9(12)13(16)20-14/h1-6H |
| InChIKey | VALMHKPCDUTIEN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |