C16H11Cl3N2 — CID 114590874
4,8-dichloro-2-(3-chloro-4-methylphenyl)-6-methylquinazoline (PubChem CID 114590874) has the molecular formula C16H11Cl3N2 and a molecular weight of 337.64 g/mol. Its IUPAC name is 4,8-dichloro-2-(3-chloro-4-methylphenyl)-6-methylquinazoline.
| Compound Name | 4,8-dichloro-2-(3-chloro-4-methylphenyl)-6-methylquinazoline |
|---|---|
| PubChem CID | 114590874 |
| Molecular Formula | C16H11Cl3N2 |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 4,8-dichloro-2-(3-chloro-4-methylphenyl)-6-methylquinazoline |
| SMILES | Cc1cc(Cl)c2nc(-c3ccc(C)c(Cl)c3)nc(Cl)c2c1 |
| InChI | InChI=1S/C16H11Cl3N2/c1-8-5-11-14(13(18)6-8)20-16(21-15(11)19)10-4-3-9(2)12(17)7-10/h3-7H,1-2H3 |
| InChIKey | JCMJXBPUDZASQR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |