2-phenylpyrimidine-4,6-dicarbonyl chloride

C12H6Cl2N2O2 — CID 71368048

IUPAC2-phenylpyrimidine-4,6-dicarbonyl chloride
SMILESO=C(Cl)c1cc(C(=O)Cl)nc(-c2ccccc2)n1
InChIInChI=1S/C12H6Cl2N2O2/c13-10(17)8-6-9(11(14)18)16-12(15-8)7-4-2-1-3-5-7/h1-6H
InChIKeyZEAOKRZGNRUZRM-UHFFFAOYSA-N
MW281.10 g/mol
LogP2.90
Rot. Bonds3

About 2-phenylpyrimidine-4,6-dicarbonyl chloride

2-phenylpyrimidine-4,6-dicarbonyl chloride (PubChem CID 71368048) has the molecular formula C12H6Cl2N2O2 and a molecular weight of 281.10 g/mol. Its IUPAC name is 2-phenylpyrimidine-4,6-dicarbonyl chloride.

Molecular Properties

Compound Name2-phenylpyrimidine-4,6-dicarbonyl chloride
PubChem CID71368048
Molecular FormulaC12H6Cl2N2O2
Molecular Weight281.10 g/mol
Exact Mass279.98
IUPAC Name2-phenylpyrimidine-4,6-dicarbonyl chloride
SMILESO=C(Cl)c1cc(C(=O)Cl)nc(-c2ccccc2)n1
InChIInChI=1S/C12H6Cl2N2O2/c13-10(17)8-6-9(11(14)18)16-12(15-8)7-4-2-1-3-5-7/h1-6H
InChIKeyZEAOKRZGNRUZRM-UHFFFAOYSA-N
XLogP2.90
TPSA59.92 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.10
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-phenylpyrimidine-4,6-dicarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenylpyrimidine-4,6-dicarbonyl chloride?
The IUPAC name of 2-phenylpyrimidine-4,6-dicarbonyl chloride (CID 71368048) is 2-phenylpyrimidine-4,6-dicarbonyl chloride.
What is the SMILES notation for 2-phenylpyrimidine-4,6-dicarbonyl chloride?
The canonical SMILES for 2-phenylpyrimidine-4,6-dicarbonyl chloride is O=C(Cl)c1cc(C(=O)Cl)nc(-c2ccccc2)n1.
What is the InChIKey of 2-phenylpyrimidine-4,6-dicarbonyl chloride?
The InChIKey is ZEAOKRZGNRUZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2N2O2/c13-10(17)8-6-9(11(14)18)16-12(15-8)7-4-2-1-3-5-7/h1-6H.
What are the key properties of 2-phenylpyrimidine-4,6-dicarbonyl chloride?
2-phenylpyrimidine-4,6-dicarbonyl chloride has a molecular weight of 281.10 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyrimidine-4,6-dicarbonyl chloride is sourced from PubChem (CID 71368048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).