About (3-hydroxyphenyl) 2-oxopropanoate
(3-hydroxyphenyl) 2-oxopropanoate (PubChem CID 22361380) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is (3-hydroxyphenyl) 2-oxopropanoate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl) 2-oxopropanoate |
| PubChem CID | 22361380 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (3-hydroxyphenyl) 2-oxopropanoate |
| SMILES | CC(=O)C(=O)Oc1cccc(O)c1 |
| InChI | InChI=1S/C9H8O4/c1-6(10)9(12)13-8-4-2-3-7(11)5-8/h2-5,11H,1H3 |
| InChIKey | WMSXDNWBIRUCJG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxyphenyl) 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl) 2-oxopropanoate?
The IUPAC name of (3-hydroxyphenyl) 2-oxopropanoate (CID 22361380) is (3-hydroxyphenyl) 2-oxopropanoate.
What is the SMILES notation for (3-hydroxyphenyl) 2-oxopropanoate?
The canonical SMILES for (3-hydroxyphenyl) 2-oxopropanoate is CC(=O)C(=O)Oc1cccc(O)c1.
What is the InChIKey of (3-hydroxyphenyl) 2-oxopropanoate?
The InChIKey is WMSXDNWBIRUCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c1-6(10)9(12)13-8-4-2-3-7(11)5-8/h2-5,11H,1H3.
What are the key properties of (3-hydroxyphenyl) 2-oxopropanoate?
(3-hydroxyphenyl) 2-oxopropanoate has a molecular weight of 180.16 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl) 2-oxopropanoate is sourced from PubChem (CID 22361380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).