C15H16O3 — CID 126707992
(3-hydroxyphenyl) (2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate (PubChem CID 126707992) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3-hydroxyphenyl) (2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate.
| Compound Name | (3-hydroxyphenyl) (2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 126707992 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3-hydroxyphenyl) (2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate |
| SMILES | C/C=C\C=C(/C=C\C)C(=O)Oc1cccc(O)c1 |
| InChI | InChI=1S/C15H16O3/c1-3-5-8-12(7-4-2)15(17)18-14-10-6-9-13(16)11-14/h3-11,16H,1-2H3/b5-3-,7-4-,12-8+ |
| InChIKey | AZJDWNAKBRXHQP-RAEMRTJTSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|