About ethane;3-methoxyphenol
ethane;3-methoxyphenol (PubChem CID 142018283) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is ethane;3-methoxyphenol.
Molecular Properties
| Compound Name | ethane;3-methoxyphenol |
| PubChem CID | 142018283 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | ethane;3-methoxyphenol |
| SMILES | CC.COc1cccc(O)c1 |
| InChI | InChI=1S/C7H8O2.C2H6/c1-9-7-4-2-3-6(8)5-7;1-2/h2-5,8H,1H3;1-2H3 |
| InChIKey | MAFMEWNBUKYBTE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methoxyphenol?
The IUPAC name of ethane;3-methoxyphenol (CID 142018283) is ethane;3-methoxyphenol.
What is the SMILES notation for ethane;3-methoxyphenol?
The canonical SMILES for ethane;3-methoxyphenol is CC.COc1cccc(O)c1.
What is the InChIKey of ethane;3-methoxyphenol?
The InChIKey is MAFMEWNBUKYBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C2H6/c1-9-7-4-2-3-6(8)5-7;1-2/h2-5,8H,1H3;1-2H3.
What are the key properties of ethane;3-methoxyphenol?
ethane;3-methoxyphenol has a molecular weight of 154.21 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methoxyphenol is sourced from PubChem (CID 142018283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).