C10H8N2O4 — CID 117218664
(3-hydroxyphenyl) 4-amino-1,2-oxazole-5-carboxylate (PubChem CID 117218664) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is (3-hydroxyphenyl) 4-amino-1,2-oxazole-5-carboxylate.
| Compound Name | (3-hydroxyphenyl) 4-amino-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 117218664 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (3-hydroxyphenyl) 4-amino-1,2-oxazole-5-carboxylate |
| SMILES | Nc1cnoc1C(=O)Oc1cccc(O)c1 |
| InChI | InChI=1S/C10H8N2O4/c11-8-5-12-16-9(8)10(14)15-7-3-1-2-6(13)4-7/h1-5,13H,11H2 |
| InChIKey | APYUILNAVMZEPL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|