C24H21ClN2O3 — CID 41142324
(5S)-5-benzyl-3-[2-(3-chlorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 41142324) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[2-(3-chlorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[2-(3-chlorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41142324 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (5S)-5-benzyl-3-[2-(3-chlorophenoxy)ethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@@](Cc2ccccc2)(c2ccccc2)C(=O)N1CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21ClN2O3/c25-20-12-7-13-21(16-20)30-15-14-27-22(28)24(26-23(27)29,19-10-5-2-6-11-19)17-18-8-3-1-4-9-18/h1-13,16H,14-15,17H2,(H,26,29)/t24-/m0/s1 |
| InChIKey | DHTKKFWRYMOVFH-DEOSSOPVSA-N |
| XLogP | 4.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|