C26H26ClN3O3 — CID 51556398
(5R)-5-benzyl-3-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 51556398) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51556398 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (5R)-5-benzyl-3-[[2-(3-chlorophenoxy)ethyl-methylamino]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | CN(CCOc1cccc(Cl)c1)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H26ClN3O3/c1-29(15-16-33-23-14-8-13-22(27)17-23)19-30-24(31)26(28-25(30)32,21-11-6-3-7-12-21)18-20-9-4-2-5-10-20/h2-14,17H,15-16,18-19H2,1H3,(H,28,32)/t26-/m1/s1 |
| InChIKey | OZBTZFVDKDRVDJ-AREMUKBSSA-N |
| XLogP | 4.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|