C20H21BrClN3O3 — CID 42998311
5-(3-bromophenyl)-3-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 42998311) has the molecular formula C20H21BrClN3O3 and a molecular weight of 466.76 g/mol. Its IUPAC name is 5-(3-bromophenyl)-3-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(3-bromophenyl)-3-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42998311 |
| Molecular Formula | C20H21BrClN3O3 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 5-(3-bromophenyl)-3-[[2-(4-chlorophenoxy)ethyl-methylamino]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CN(CCOc1ccc(Cl)cc1)CN1C(=O)NC(C)(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C20H21BrClN3O3/c1-20(14-4-3-5-15(21)12-14)18(26)25(19(27)23-20)13-24(2)10-11-28-17-8-6-16(22)7-9-17/h3-9,12H,10-11,13H2,1-2H3,(H,23,27) |
| InChIKey | GCFFJWSDZALCDN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|