C19H17ClN6O3 — CID 41111698
(5R)-3-[2-(3-chlorophenoxy)ethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 41111698) has the molecular formula C19H17ClN6O3 and a molecular weight of 412.84 g/mol. Its IUPAC name is (5R)-3-[2-(3-chlorophenoxy)ethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(3-chlorophenoxy)ethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41111698 |
| Molecular Formula | C19H17ClN6O3 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (5R)-3-[2-(3-chlorophenoxy)ethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cccc(-n3cnnn3)c2)NC(=O)N(CCOc2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C19H17ClN6O3/c1-19(13-4-2-6-15(10-13)26-12-21-23-24-26)17(27)25(18(28)22-19)8-9-29-16-7-3-5-14(20)11-16/h2-7,10-12H,8-9H2,1H3,(H,22,28)/t19-/m1/s1 |
| InChIKey | JUIXIOAGDJHRQK-LJQANCHMSA-N |
| XLogP | 2.16 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|