C21H17N7O3 — CID 40804493
(5R)-5-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 40804493) has the molecular formula C21H17N7O3 and a molecular weight of 415.41 g/mol. Its IUPAC name is (5R)-5-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40804493 |
| Molecular Formula | C21H17N7O3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (5R)-5-methyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cccc(-n3cnnn3)c2)NC(=O)N(Cc2cc(-c3ccccc3)on2)C1=O |
| InChI | InChI=1S/C21H17N7O3/c1-21(15-8-5-9-17(10-15)28-13-22-25-26-28)19(29)27(20(30)23-21)12-16-11-18(31-24-16)14-6-3-2-4-7-14/h2-11,13H,12H2,1H3,(H,23,30)/t21-/m1/s1 |
| InChIKey | MAPCGTLRISJHCF-OAQYLSRUSA-N |
| XLogP | 2.28 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|