C21H19N7O3 — CID 41320331
(5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 41320331) has the molecular formula C21H19N7O3 and a molecular weight of 417.43 g/mol. Its IUPAC name is (5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41320331 |
| Molecular Formula | C21H19N7O3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cccc(-n3cnnn3)c2)NC(=O)N(CC(=O)N2CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H19N7O3/c1-21(15-6-4-7-16(11-15)28-13-22-24-25-28)19(30)27(20(31)23-21)12-18(29)26-10-9-14-5-2-3-8-17(14)26/h2-8,11,13H,9-10,12H2,1H3,(H,23,31)/t21-/m0/s1 |
| InChIKey | SRBGKHKMUZKANR-NRFANRHFSA-N |
| XLogP | 1.02 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|