C21H18F3N3O3 — CID 51951395
(5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 51951395) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is (5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51951395 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (5S)-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cccc(C(F)(F)F)c2)NC(=O)N(CC(=O)N2CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H18F3N3O3/c1-20(14-6-4-7-15(11-14)21(22,23)24)18(29)27(19(30)25-20)12-17(28)26-10-9-13-5-2-3-8-16(13)26/h2-8,11H,9-10,12H2,1H3,(H,25,30)/t20-/m0/s1 |
| InChIKey | CAXSCIRUSFDXEL-FQEVSTJZSA-N |
| XLogP | 3.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|