C23H23N7O4 — CID 42920903
2-methyl-N-[4-[2-[4-methyl-2,5-dioxo-4-[3-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]acetyl]phenyl]propanamide (PubChem CID 42920903) has the molecular formula C23H23N7O4 and a molecular weight of 461.48 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[4-methyl-2,5-dioxo-4-[3-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]acetyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[2-[4-methyl-2,5-dioxo-4-[3-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]acetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 42920903 |
| Molecular Formula | C23H23N7O4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-methyl-N-[4-[2-[4-methyl-2,5-dioxo-4-[3-(tetrazol-1-yl)phenyl]imidazolidin-1-yl]acetyl]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)CN2C(=O)NC(C)(c3cccc(-n4cnnn4)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H23N7O4/c1-14(2)20(32)25-17-9-7-15(8-10-17)19(31)12-29-21(33)23(3,26-22(29)34)16-5-4-6-18(11-16)30-13-24-27-28-30/h4-11,13-14H,12H2,1-3H3,(H,25,32)(H,26,34) |
| InChIKey | PZHCFCMVPRUTII-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|