C23H25N3O4 — CID 7171116
3-methyl-N-[4-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]phenyl]butanamide (PubChem CID 7171116) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-methyl-N-[4-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]phenyl]butanamide |
|---|---|
| PubChem CID | 7171116 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-methyl-N-[4-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)CN2C(=O)N[C@](C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-15(2)13-20(28)24-18-11-9-16(10-12-18)19(27)14-26-21(29)23(3,25-22(26)30)17-7-5-4-6-8-17/h4-12,15H,13-14H2,1-3H3,(H,24,28)(H,25,30)/t23-/m1/s1 |
| InChIKey | KMOQIKDABCHZFE-HSZRJFAPSA-N |
| XLogP | 3.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|