C21H20ClN3O4 — CID 7180488
N-[4-[2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]phenyl]propanamide (PubChem CID 7180488) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is N-[4-[2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]phenyl]propanamide.
| Compound Name | N-[4-[2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 7180488 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[4-[2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)CN2C(=O)N[C@@](C)(c3ccccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H20ClN3O4/c1-3-18(27)23-14-10-8-13(9-11-14)17(26)12-25-19(28)21(2,24-20(25)29)15-6-4-5-7-16(15)22/h4-11H,3,12H2,1-2H3,(H,23,27)(H,24,29)/t21-/m0/s1 |
| InChIKey | WNNBPUHNBLSPFY-NRFANRHFSA-N |
| XLogP | 3.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|