C19H16N8O2 — CID 42918844
3-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 42918844) has the molecular formula C19H16N8O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42918844 |
| Molecular Formula | C19H16N8O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methyl-5-[3-(tetrazol-1-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2cccc(-n3cnnn3)c2)NC(=O)N(Cc2cn3ccccc3n2)C1=O |
| InChI | InChI=1S/C19H16N8O2/c1-19(13-5-4-6-15(9-13)27-12-20-23-24-27)17(28)26(18(29)22-19)11-14-10-25-8-3-2-7-16(25)21-14/h2-10,12H,11H2,1H3,(H,22,29) |
| InChIKey | UIDKKVDMGNXPHN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|