C17H14N2O2 — CID 98155460
3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]benzonitrile (PubChem CID 98155460) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]benzonitrile.
| Compound Name | 3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 98155460 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c1 |
| InChI | InChI=1S/C17H14N2O2/c18-8-10-2-1-3-11(6-10)9-19-16(20)14-12-4-5-13(7-12)15(14)17(19)21/h1-6,12-15H,7,9H2/t12-,13-,14-,15+/m0/s1 |
| InChIKey | SVKKNXGLPHJSGA-ZQDZILKHSA-N |
| XLogP | 1.87 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|