C17H18N2O2 — CID 60976545
3-[(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)methyl]benzonitrile (PubChem CID 60976545) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-[(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)methyl]benzonitrile.
| Compound Name | 3-[(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 60976545 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2C(=O)CC3(CCCC3)CC2=O)c1 |
| InChI | InChI=1S/C17H18N2O2/c18-11-13-4-3-5-14(8-13)12-19-15(20)9-17(10-16(19)21)6-1-2-7-17/h3-5,8H,1-2,6-7,9-10,12H2 |
| InChIKey | AFMPYLXHOKHPPE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|