C16H18BrNO2 — CID 60976541
8-[(3-bromophenyl)methyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 60976541) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 8-[(3-bromophenyl)methyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[(3-bromophenyl)methyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 60976541 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 8-[(3-bromophenyl)methyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H18BrNO2/c17-13-5-3-4-12(8-13)11-18-14(19)9-16(10-15(18)20)6-1-2-7-16/h3-5,8H,1-2,6-7,9-11H2 |
| InChIKey | HSNRIEYFDRTSSN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|