C16H18N4O2 — CID 82148682
3-[(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile (PubChem CID 82148682) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-[(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile.
| Compound Name | 3-[(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 82148682 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[(8-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]benzonitrile |
| SMILES | CN1CCC2(CC1)NC(=O)N(Cc1cccc(C#N)c1)C2=O |
| InChI | InChI=1S/C16H18N4O2/c1-19-7-5-16(6-8-19)14(21)20(15(22)18-16)11-13-4-2-3-12(9-13)10-17/h2-4,9H,5-8,11H2,1H3,(H,18,22) |
| InChIKey | FCVMHJMJEGKEEZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|