C22H24N6O6 — CID 55579075
1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 55579075) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 55579075 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CN1C(=O)C(=O)N(c3ccccc3OCC)C1=O)n2C |
| InChI | InChI=1S/C22H24N6O6/c1-4-6-11-26-17-16(18(29)24-21(26)32)25(3)15(23-17)12-27-19(30)20(31)28(22(27)33)13-9-7-8-10-14(13)34-5-2/h7-10H,4-6,11-12H2,1-3H3,(H,24,29,32) |
| InChIKey | SHVLFRAFDOOJIP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 139.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|