C23H37N5O5 — CID 34708940
[2-oxo-2-(pentylamino)ethyl] 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate (PubChem CID 34708940) has the molecular formula C23H37N5O5 and a molecular weight of 463.58 g/mol. Its IUPAC name is [2-oxo-2-(pentylamino)ethyl] 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate.
| Compound Name | [2-oxo-2-(pentylamino)ethyl] 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate |
|---|---|
| PubChem CID | 34708940 |
| Molecular Formula | C23H37N5O5 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | [2-oxo-2-(pentylamino)ethyl] 3-[3-butyl-7-(2-methylpropyl)-2,6-dioxopurin-8-yl]propanoate |
| SMILES | CCCCCNC(=O)COC(=O)CCc1nc2c(c(=O)[nH]c(=O)n2CCCC)n1CC(C)C |
| InChI | InChI=1S/C23H37N5O5/c1-5-7-9-12-24-18(29)15-33-19(30)11-10-17-25-21-20(28(17)14-16(3)4)22(31)26-23(32)27(21)13-8-6-2/h16H,5-15H2,1-4H3,(H,24,29)(H,26,31,32) |
| InChIKey | UVXUSSFUCCXMOZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|