C26H32N6O3 — CID 26242280
3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-quinolin-5-ylpropanamide (PubChem CID 26242280) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-quinolin-5-ylpropanamide.
| Compound Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-quinolin-5-ylpropanamide |
|---|---|
| PubChem CID | 26242280 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-quinolin-5-ylpropanamide |
| SMILES | CCCCCn1c(CCC(=O)Nc2cccc3ncccc23)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C26H32N6O3/c1-3-5-7-17-31-21(29-24-23(31)25(34)30-26(35)32(24)16-6-4-2)13-14-22(33)28-20-12-8-11-19-18(20)10-9-15-27-19/h8-12,15H,3-7,13-14,16-17H2,1-2H3,(H,28,33)(H,30,34,35) |
| InChIKey | BELIMWJLYLMLIQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|