C25H32N8O3 — CID 30887067
3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-pyrazol-1-yl-3-pyridinyl)propanamide (PubChem CID 30887067) has the molecular formula C25H32N8O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-pyrazol-1-yl-3-pyridinyl)propanamide.
| Compound Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-pyrazol-1-yl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 30887067 |
| Molecular Formula | C25H32N8O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 3-(3-butyl-2,6-dioxo-7-pentylpurin-8-yl)-N-(2-pyrazol-1-yl-3-pyridinyl)propanamide |
| SMILES | CCCCCn1c(CCC(=O)Nc2cccnc2-n2cccn2)nc2c1c(=O)[nH]c(=O)n2CCCC |
| InChI | InChI=1S/C25H32N8O3/c1-3-5-7-16-31-19(29-23-21(31)24(35)30-25(36)32(23)15-6-4-2)11-12-20(34)28-18-10-8-13-26-22(18)33-17-9-14-27-33/h8-10,13-14,17H,3-7,11-12,15-16H2,1-2H3,(H,28,34)(H,30,35,36) |
| InChIKey | ZDGKSJUCOCILGY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|