C24H40N6O4 — CID 164595496
tert-butyl N-[1-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)piperidin-3-yl]carbamate;ethane (PubChem CID 164595496) has the molecular formula C24H40N6O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is tert-butyl N-[1-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)piperidin-3-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)piperidin-3-yl]carbamate;ethane |
|---|---|
| PubChem CID | 164595496 |
| Molecular Formula | C24H40N6O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | tert-butyl N-[1-(7-but-2-ynyl-3-methyl-2,6-dioxopurin-8-yl)piperidin-3-yl]carbamate;ethane |
| SMILES | CC.CC.CC#CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C20H28N6O4.2C2H6/c1-6-7-11-26-14-15(24(5)18(28)23-16(14)27)22-17(26)25-10-8-9-13(12-25)21-19(29)30-20(2,3)4;2*1-2/h13H,8-12H2,1-5H3,(H,21,29)(H,23,27,28);2*1-2H3 |
| InChIKey | SKMJECNHYZOAFA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|