C13H13FN2O4S — CID 18920046
methyl 2-(fluoromethyl)-4-imidazol-1-yl-5-methylsulfonylbenzoate (PubChem CID 18920046) has the molecular formula C13H13FN2O4S and a molecular weight of 312.32 g/mol. Its IUPAC name is methyl 2-(fluoromethyl)-4-imidazol-1-yl-5-methylsulfonylbenzoate.
| Compound Name | methyl 2-(fluoromethyl)-4-imidazol-1-yl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18920046 |
| Molecular Formula | C13H13FN2O4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | methyl 2-(fluoromethyl)-4-imidazol-1-yl-5-methylsulfonylbenzoate |
| SMILES | COC(=O)c1cc(S(C)(=O)=O)c(-n2ccnc2)cc1CF |
| InChI | InChI=1S/C13H13FN2O4S/c1-20-13(17)10-6-12(21(2,18)19)11(5-9(10)7-14)16-4-3-15-8-16/h3-6,8H,7H2,1-2H3 |
| InChIKey | DPTXJZKISZUSQM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |